CAS 5585-52-4 is the registry number for 2-Methyl-3-phenylbutan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-3-phenylbutan-2-amine;hydrochloride (CAS 5585-52-4) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 2-methyl-3-phenylbutan-2-amine;hydrochloride. InChIKey: QIDLIADDZYBVKK-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 2-methyl-3-phenylbutan-2-amine;hydrochloride |
| InChIKey | QIDLIADDZYBVKK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C(C)(C)N.Cl |
Computed by PubChem (NCBI)