Products 55954-23-9
CAS 55954-23-9 appears in our catalog under these names: DCAA Methyl Ester 100 µg/mL in Methyl tert-butyl ether, Methyl 2,4–Dichlorophenylacetate, Methyl 2,4-Dichlorophenylacetate, >99.0%(GC), Methyl 2,4-dichlorophenylacetate 97%, Methyl 2,4-dichlorophenylacetate, 98%. Offered by: Dr. Ehrenstorfer, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5x1ml, 100g, 25g, 5g, 10g, 500g.
Methyl 2-(2,4-dichlorophenyl)acetate (CAS 55954-23-9) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2-(2,4-dichlorophenyl)acetate. InChIKey: SRCVNBFTEARRJY-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2-(2,4-dichlorophenyl)acetate |
| InChIKey | SRCVNBFTEARRJY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl 2,4-dichlorobenzeneacetate, Methyl 2,4-Dichlorophenylacetate, methyl 2-(2,4-dichlorophenyl)acetate, 2,4-Dichlorophenylacetic acid methyl ester, Methyl2,4-dichlorophenylacetate, Benzeneacetic acid, 2,4-dichloro-, methyl ester, DCAA methyl ester, 2,4-dichlorobenzeneacetic acid methyl ester, (2,4-dichlorophenyl)acetic acid methyl ester, Methyl 24-dichlorophenylacetate