CAS 55974-25-9 is the registry number for Gliquidone Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-4,4-dimethylisochromene-1,3-dione (CAS 55974-25-9) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 7-methoxy-4,4-dimethylisochromene-1,3-dione. InChIKey: XAFPBWJMFWANOI-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 7-methoxy-4,4-dimethylisochromene-1,3-dione |
| InChIKey | XAFPBWJMFWANOI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)OC)C(=O)OC1=O)C |
Computed by PubChem (NCBI)