Products 5600-62-4
CAS 5600-62-4 appears in our catalog under these names: 4–(4–Nitrophenyl)butyric acid, 4-(4-Nitrophenyl)butanoic acid 98+%, 4-(4-Nitrophenyl)butyric acid, 98%, 4-(4-Nitrophenyl)butanoic acid, 98%, 98%, 4-Nitro benzenebutanoic acid. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Biosynth. Available pack sizes: 1g, 25g, 5g, 100g, 250mg.
4-(4-nitrophenyl)butanoic acid (CAS 5600-62-4) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 4-(4-nitrophenyl)butanoic acid. InChIKey: WQMLUHZFRFCQDB-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-(4-nitrophenyl)butanoic acid |
| InChIKey | WQMLUHZFRFCQDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(4-Nitrophenyl)butyric acid, 4-(4-Nitrophenyl)butanoic acid, 4-(4-Nitro-phenyl)-butyric acid, 4-(p-Nitrophenyl)butyric acid, 4-Nitrobenzenebutanoic acid, Benzenebutanoic acid, 4-nitro-, .gamma.-(p-Nitrophenyl)butyric acid, 4-{4-nitrophenyl}butanoic acid, 4-Nitro benzenebutanoic acid, 4-Nitro-benzenebutanoic acid