Products 1445578-20-0
CAS 1445578-20-0 appears in our catalog under these names: XLR11 N-(4-Pentenyl) Analog, XLR11 N–(4–pentenyl) analog, (1-(pent-4-en-1-yl)-1H-indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 1mg, 10mg, 5mg, 50mg.
(1-pent-4-enylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 1445578-20-0) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: (1-pent-4-enylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: NXTLUQFOTQPMOD-UHFFFAOYSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (1-pent-4-enylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | NXTLUQFOTQPMOD-UHFFFAOYSA-N |
| SMILES | CC1(C(C1(C)C)C(=O)C2=CN(C3=CC=CC=C32)CCCC=C)C |
Computed by PubChem (NCBI)