Products 561013-47-6
CAS 561013-47-6 is the registry number for 6-(Methoxymethoxy)-2-naphthoic acid, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
6-(methoxymethoxy)naphthalene-2-carboxylic acid (CAS 561013-47-6) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 6-(methoxymethoxy)naphthalene-2-carboxylic acid. InChIKey: YADSXVONQHIUDP-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 6-(methoxymethoxy)naphthalene-2-carboxylic acid |
| InChIKey | YADSXVONQHIUDP-UHFFFAOYSA-N |
| SMILES | COCOC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)