Products 561013-50-1
CAS 561013-50-1 appears in our catalog under these names: 6-Propoxy-2-naphthoic acid, 95%, 6-Propoxy-2-naphthoic acid, 98%, 6-Propoxy-2-naphthoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
6-propoxynaphthalene-2-carboxylic acid (CAS 561013-50-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 6-propoxynaphthalene-2-carboxylic acid. InChIKey: FPJJVIAKWJHUMA-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 6-propoxynaphthalene-2-carboxylic acid |
| InChIKey | FPJJVIAKWJHUMA-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)