CAS 56136-79-9 is the registry number for 2-Chloro-4,5-dinitro-toluene. Offered by: TRC. Available pack sizes: 1g.
1-chloro-2-methyl-4,5-dinitrobenzene (CAS 56136-79-9) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 1-chloro-2-methyl-4,5-dinitrobenzene. InChIKey: WQSOOJHJGVAMQN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 1-chloro-2-methyl-4,5-dinitrobenzene |
| InChIKey | WQSOOJHJGVAMQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)