CAS 56205-88-0 appears in our catalog under these names: Dofetilide Impurity 13, 2-(4-(Methylsulfonamido)phenyl)acetic Acid, 4-(Methylsulphonylamino)phenylacetic Acid 97%, 4-(Methylsulphonylamino)phenylacetic Acid, >97%, >97%, 2-(4-(Methylsulfonamido)phenyl)acetic acid, >97%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 250mg, 5g, 25g, 100mg.
2-[4-(methanesulfonamido)phenyl]acetic acid (CAS 56205-88-0) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[4-(methanesulfonamido)phenyl]acetic acid. InChIKey: FSTWMOUDEJBNAO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-[4-(methanesulfonamido)phenyl]acetic acid |
| InChIKey | FSTWMOUDEJBNAO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)