CAS 5622-06-0 appears in our catalog under these names: 6-Chloro-8-hydroxyquinoline, 95%, 6–Chloro–8–Hydroxyquinoline, 6-chloroquinolin-8-ol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 10g, 250mg, 25g, 1g, 5g, 100mg, 0,5g.
6-chloroquinolin-8-ol (CAS 5622-06-0) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 6-chloroquinolin-8-ol. InChIKey: YFKDOLPRGYKULB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 6-chloroquinolin-8-ol |
| InChIKey | YFKDOLPRGYKULB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)Cl |
Computed by PubChem (NCBI)