CAS 56304-43-9 is the registry number for 2-Oxo-6-(pyridin-3-yl)-1,2-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-oxo-6-pyridin-3-yl-1H-pyridine-3-carboxylic acid (CAS 56304-43-9) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 2-oxo-6-pyridin-3-yl-1H-pyridine-3-carboxylic acid. InChIKey: PVZPPPFCSRLPSW-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 2-oxo-6-pyridin-3-yl-1H-pyridine-3-carboxylic acid |
| InChIKey | PVZPPPFCSRLPSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)