Products 563538-33-0
CAS 563538-33-0 appears in our catalog under these names: (4-Hydroxyphenyl)(piperazin-1-yl)methanone, 95%, 95%, (4-Hydroxy-phenyl)-piperazin-1-yl-methanone. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 2.5g.
(4-hydroxyphenyl)-piperazin-1-ylmethanone (CAS 563538-33-0) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: (4-hydroxyphenyl)-piperazin-1-ylmethanone. InChIKey: ODJPRCJSCMHSOS-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (4-hydroxyphenyl)-piperazin-1-ylmethanone |
| InChIKey | ODJPRCJSCMHSOS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)