Products 56358-60-2
CAS 56358-60-2 is the registry number for Methyl 6-(Bromomethyl)-2-naphthoate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 6-(bromomethyl)naphthalene-2-carboxylate (CAS 56358-60-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: methyl 6-(bromomethyl)naphthalene-2-carboxylate. InChIKey: XBTKJZFLHRRZQG-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | methyl 6-(bromomethyl)naphthalene-2-carboxylate |
| InChIKey | XBTKJZFLHRRZQG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)CBr |
Computed by PubChem (NCBI)