CAS 56410-30-1 appears in our catalog under these names: Benzyl 2,4-Dihydroxy-3,6-dimethylbenzoate, Benzyl 2,4-dihydroxy-3,6-dimethylbenzoate, 95%, benzyl 2,4-dihydroxy-3,6-dimethylbenzoate, 95%, 95%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10mg, 5mg.
Benzyl 2,4-dihydroxy-3,6-dimethylbenzoate (CAS 56410-30-1) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: benzyl 2,4-dihydroxy-3,6-dimethylbenzoate. InChIKey: VSKQSANOBRVUSO-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | benzyl 2,4-dihydroxy-3,6-dimethylbenzoate |
| InChIKey | VSKQSANOBRVUSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OCC2=CC=CC=C2)O)C)O |
Computed by PubChem (NCBI)