CAS 56487-68-4 appears in our catalog under these names: Cefradine Impurity 16, delta-2-7-Aminodesacetoxycephalosporanic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (CAS 56487-68-4) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid. InChIKey: UZSAPRGFDMQMTB-TWQFUJJMSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| InChIKey | UZSAPRGFDMQMTB-TWQFUJJMSA-N |
| SMILES | CC1=CS[C@@H]2[C@@H](C(=O)N2C1C(=O)O)N |
Computed by PubChem (NCBI)