Products 566155-74-6
CAS 566155-74-6 is the registry number for 1,4-Benzenedicarboxylic acid, 2-(phenylamino)-, dimethyl ester. Offered by: Chemat. Available pack sizes: 1g.
Dimethyl 2-anilinobenzene-1,4-dicarboxylate (CAS 566155-74-6) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: dimethyl 2-anilinobenzene-1,4-dicarboxylate. InChIKey: SBHNKIGYTHNEAR-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | dimethyl 2-anilinobenzene-1,4-dicarboxylate |
| InChIKey | SBHNKIGYTHNEAR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
dimethyl 2-(phenylamino)benzene-1,4-dioate, Dimethyl 2-anilinobenzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, 2-(phenylamino)-, dimethyl ester, 5-phenylamino-terephthalic Acid Dimethyl Ester, SBHNKIGYTHNEAR-UHFFFAOYSA-N, dimethyl 2-phenylamino-terephthalate, dimethyl2-(phenylamino)benzene-1,4-dioate, 1,4-Dimethyl 2-(phenylamino)-1,4-benzenedicarboxylate