CAS 566945-71-9 appears in our catalog under these names: 4-Chloro-2-hydroxy-n-methoxy-n-methylbenzamide, 95%, 4-Chloro-2-hydroxy-N-methoxy-N-methylbenzamide, 97%, 4–Chloro–2–hydroxy–N–methoxy–N–methylbenzamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-chloro-2-hydroxy-N-methoxy-N-methylbenzamide (CAS 566945-71-9) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 4-chloro-2-hydroxy-N-methoxy-N-methylbenzamide. InChIKey: JKGGNALVUODGML-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 4-chloro-2-hydroxy-N-methoxy-N-methylbenzamide |
| InChIKey | JKGGNALVUODGML-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C=C(C=C1)Cl)O)OC |
Computed by PubChem (NCBI)