CAS 5670-69-9 is the registry number for 1,1-Diphenyl-2-nitroethylene. Offered by: TRC. Available pack sizes: 1g.
(2-nitro-1-phenylethenyl)benzene (CAS 5670-69-9) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: (2-nitro-1-phenylethenyl)benzene. InChIKey: OYDWWBGGMKUUNB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (2-nitro-1-phenylethenyl)benzene |
| InChIKey | OYDWWBGGMKUUNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)