Products 568553-40-2
CAS 568553-40-2 is the registry number for 3-({3-Carbamoyl-4H,5H,6H-cyclopenta(b)thiophen-2-yl}carbamoyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobutanoic acid (CAS 568553-40-2) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: 4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobutanoic acid. InChIKey: MYHMYWHHVFPELS-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 4-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-4-oxobutanoic acid |
| InChIKey | MYHMYWHHVFPELS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)N)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)