Products 568567-38-4
CAS 568567-38-4 is the registry number for 2-Chloro-N-(2-(difluoromethoxy)phenyl)acetamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-N-[2-(difluoromethoxy)phenyl]acetamide (CAS 568567-38-4) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: 2-chloro-N-[2-(difluoromethoxy)phenyl]acetamide. InChIKey: VSWMMCQGPNBKSH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | 2-chloro-N-[2-(difluoromethoxy)phenyl]acetamide |
| InChIKey | VSWMMCQGPNBKSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)OC(F)F |
Computed by PubChem (NCBI)