Products 56860-22-1
CAS 56860-22-1 is the registry number for 3,6-Bis(dimethylamino)-9H-fluoren-9-one, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
3,6-bis(dimethylamino)fluoren-9-one (CAS 56860-22-1) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: 3,6-bis(dimethylamino)fluoren-9-one. InChIKey: JMTHFWKNDRWXEU-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 3,6-bis(dimethylamino)fluoren-9-one |
| InChIKey | JMTHFWKNDRWXEU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=O)C3=C2C=C(C=C3)N(C)C |
Computed by PubChem (NCBI)