Products 56966-49-5
CAS 56966-49-5 appears in our catalog under these names: 4-Chloro-2-(4-chlorophenoxy)aniline 95+%, 4-Chloro-2-(4-chlorophenoxy)aniline, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-(4-chlorophenoxy)aniline (CAS 56966-49-5) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 4-chloro-2-(4-chlorophenoxy)aniline. InChIKey: HDGZIHCCEYFXMQ-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 4-chloro-2-(4-chlorophenoxy)aniline |
| InChIKey | HDGZIHCCEYFXMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=CC(=C2)Cl)N)Cl |
Computed by PubChem (NCBI)