Products 57053-02-8
CAS 57053-02-8 appears in our catalog under these names: Dimethyl 2-aminoisophthalate, 98%, 1,3–dimethyl 2–aminobenzene–1,3–dicarboxylate, Dimethyl 2-Aminoisophthalate, >98.0%(HPLC)(T), Dimethyl 2-aminoisophthalate 98%, Dimethyl 2-Aminoisophthalate, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 250mg, 50g.
Dimethyl 2-aminobenzene-1,3-dicarboxylate (CAS 57053-02-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 2-aminobenzene-1,3-dicarboxylate. InChIKey: QVBQPOJYBWWILD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 2-aminobenzene-1,3-dicarboxylate |
| InChIKey | QVBQPOJYBWWILD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)N |
Computed by PubChem (NCBI)