Products 57082-24-3
CAS 57082-24-3 is the registry number for Vetynal extra. Offered by: Biosynth. Available pack sizes: 250g.
[(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl] acetate (CAS 57082-24-3) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: [(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl] acetate. InChIKey: SJDDHMSVZMBJPH-YQFWSFKMSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | [(1R,2S,5R,8S)-4,4,8-trimethyl-1-tricyclo[6.3.1.02,5]dodecanyl] acetate |
| InChIKey | SJDDHMSVZMBJPH-YQFWSFKMSA-N |
| SMILES | CC(=O)O[C@]12CCC[C@](C1)(CC[C@@H]3[C@@H]2CC3(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
Caryophyllene acetate, Caryophyllen acetate, beta-Caryophyllene alcohol acetate, Caryophyllene alcohol acetate, beta-, 3-06-00-00424 (Beilstein Handbook Reference), Tricyclo(6.3.1.02,5)dodecan-1-ol, 4,4,8-trimethyl-, 1-acetate, (1R,2S,5R,8S)-, .BETA.-CARYOPHYLLENE ALCOHOL ACETATE, .BETA.-CARYOPHYLLENE ALCOHOL ACETATE, (+)-, Tricyclo[6.3.1.02,5]dodecan-1-ol, 4,4,8-trimethyl-, 1-acetate, (1R,2S,5R,8S)-, 4,4,8-trimethyltricyclo(6.3.1.0^(2,5))dodecan-1-yl acetate