Products 57135-68-9
CAS 57135-68-9 is the registry number for 2-Chloro-5-nitrophenyl isothiocyanate, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1-chloro-2-isothiocyanato-4-nitrobenzene (CAS 57135-68-9) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 1-chloro-2-isothiocyanato-4-nitrobenzene. InChIKey: QSSZYQDXSYYXKK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 1-chloro-2-isothiocyanato-4-nitrobenzene |
| InChIKey | QSSZYQDXSYYXKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N=C=S)Cl |
Computed by PubChem (NCBI)