CAS 57183-50-3 appears in our catalog under these names: 6–Methoxy–2–phenyl–1H–quinolin–4–one, 4(1H)-Quinolinone,6-methoxy-2-phenyl-. Offered by: GLPBio, Chemat. Available pack sizes: 1mg, 5mg.
6-methoxy-2-phenyl-1H-quinolin-4-one (CAS 57183-50-3) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 6-methoxy-2-phenyl-1H-quinolin-4-one. InChIKey: CKFBIYVXNYYXAI-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 6-methoxy-2-phenyl-1H-quinolin-4-one |
| InChIKey | CKFBIYVXNYYXAI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=CC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)