CAS 57543-40-5 appears in our catalog under these names: 6-Methoxy-2h-chromene-3-carbaldehyde, 95%, 6-Methoxy-2H-chromene-3-carbaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
6-methoxy-2H-chromene-3-carbaldehyde (CAS 57543-40-5) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 6-methoxy-2H-chromene-3-carbaldehyde. InChIKey: BTRAXMCPHYMXAL-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 6-methoxy-2H-chromene-3-carbaldehyde |
| InChIKey | BTRAXMCPHYMXAL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(=C2)C=O |
Computed by PubChem (NCBI)