CAS 57877-28-8 is the registry number for 2-tert-Butylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-tert-butylbenzenesulfonyl chloride (CAS 57877-28-8) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 2-tert-butylbenzenesulfonyl chloride. InChIKey: ICXIVBYQRNOIJJ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 2-tert-butylbenzenesulfonyl chloride |
| InChIKey | ICXIVBYQRNOIJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)