CAS 57883-28-0 is the registry number for 1-Ethyl-7-nitro-1,2,3,4-tetrahydroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
1-ethyl-7-nitro-3,4-dihydro-2H-quinoline (CAS 57883-28-0) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-ethyl-7-nitro-3,4-dihydro-2H-quinoline. InChIKey: TUCATNRJGJWEKT-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-ethyl-7-nitro-3,4-dihydro-2H-quinoline |
| InChIKey | TUCATNRJGJWEKT-UHFFFAOYSA-N |
| SMILES | CCN1CCCC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)