Products 581785-29-7
CAS 581785-29-7 appears in our catalog under these names: Di-tert-butyl (S)-2-aminohexanedioate, 98%, 98%, Di-tert-butyl (S)-2-aminohexanedioate, 98%, H-Aad(OtBu)-OtBu, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Ditert-butyl (2S)-2-aminohexanedioate (CAS 581785-29-7) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: ditert-butyl (2S)-2-aminohexanedioate. InChIKey: GADCOXFZALWVJI-JTQLQIEISA-N.
| Molecular formula | C14H27NO4 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | ditert-butyl (2S)-2-aminohexanedioate |
| InChIKey | GADCOXFZALWVJI-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)CCC[C@@H](C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)