Products 58244-28-3
CAS 58244-28-3 appears in our catalog under these names: Phenylhydroquinone diacetate, 95%, (1,1'-Biphenyl)-2,5-diyl diacetate, 95+%, Phenyl hydroquinone diacetate, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g.
(4-acetyloxy-3-phenylphenyl) acetate (CAS 58244-28-3) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (4-acetyloxy-3-phenylphenyl) acetate. InChIKey: DZVDHXPXHBVBNZ-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (4-acetyloxy-3-phenylphenyl) acetate |
| InChIKey | DZVDHXPXHBVBNZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC(=O)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(1,1'-Biphenyl)-2,5-diol, diacetate, [1,1'-Biphenyl]-2,5-diol, diacetate, (1,1'-Biphenyl)-2,5-diol, 2,5-diacetate, Phenylhydroquinone diacetate, [1,1'-Biphenyl]-2,5-diyl diacetate, Phenyl hydroquinone diacetate, (4-acetyloxy-3-phenylphenyl) acetate, biphenyl-2,5-diyl diacetate, (1,1'-Biphenyl)-2,5-diol diacetate, Phenylhydrochinondiacetat