Products 58264-95-2
CAS 58264-95-2 appears in our catalog under these names: Serotonin-d4, Serotonin–d4, Serotonin-d4, 99.60%. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol (CAS 58264-95-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 180.24 g/mol. IUPAC name: 3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol. InChIKey: QZAYGJVTTNCVMB-KHORGVISSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | 3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol |
| InChIKey | QZAYGJVTTNCVMB-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)O)C([2H])([2H])N |
Computed by PubChem (NCBI)