Products 58266-81-2
CAS 58266-81-2 is the registry number for Sedoheptulose Anhydride Monohydrate. Offered by: TRC. Available pack sizes: 100mg.
(1R,2S,3R,4S,5R)-5-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol;hydrate (CAS 58266-81-2) is a chemical compound with the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. IUPAC name: (1R,2S,3R,4S,5R)-5-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol;hydrate. InChIKey: TXADMKCMMLBFTL-CQJQEINESA-N.
| Molecular formula | C7H14O7 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (1R,2S,3R,4S,5R)-5-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol;hydrate |
| InChIKey | TXADMKCMMLBFTL-CQJQEINESA-N |
| SMILES | C1[C@@H]2[C@H]([C@H]([C@@H]([C@](O1)(O2)CO)O)O)O.O |
Computed by PubChem (NCBI)