CAS 58490-99-6 is the registry number for N-(7-Nitro-1,2,3,4-tetrahydronaphthalen-1-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(NE)-N-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (CAS 58490-99-6) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: (NE)-N-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine. InChIKey: VPBBNFCFLAHMSJ-ZHACJKMWSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | (NE)-N-(7-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| InChIKey | VPBBNFCFLAHMSJ-ZHACJKMWSA-N |
| SMILES | C1CC2=C(C=C(C=C2)[N+](=O)[O-])/C(=N/O)/C1 |
Computed by PubChem (NCBI)