CAS 58509-24-3 appears in our catalog under these names: Amlodipine Impurity 85, Amlodipine Impurity 51, N-(2-Hydroxyethyl)phthalimic Acid, 2-[[(2-Hydroxyethyl)amino]carbonyl]benzoic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(2-hydroxyethylcarbamoyl)benzoic acid (CAS 58509-24-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-(2-hydroxyethylcarbamoyl)benzoic acid. InChIKey: IRNHGPPDXYUKFY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-(2-hydroxyethylcarbamoyl)benzoic acid |
| InChIKey | IRNHGPPDXYUKFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCO)C(=O)O |
Computed by PubChem (NCBI)