CAS 58550-89-3 appears in our catalog under these names: 3-Chloroquinolin-4-ol, 95+%, 3-CHLOROQUINOLIN-4-OL, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 1mg.
3-chloro-1H-quinolin-4-one (CAS 58550-89-3) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloro-1H-quinolin-4-one. InChIKey: GWCHTTSPSUWRBA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloro-1H-quinolin-4-one |
| InChIKey | GWCHTTSPSUWRBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CN2)Cl |
Computed by PubChem (NCBI)