CAS 58599-00-1 is the registry number for 2-(3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]acetonitrile (CAS 58599-00-1) is a chemical compound with the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. IUPAC name: 2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]acetonitrile. InChIKey: TVZDQYNVPUMYIQ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]acetonitrile |
| InChIKey | TVZDQYNVPUMYIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)CC#N |
Computed by PubChem (NCBI)