CAS 58636-31-0 is the registry number for 1-(3-(4-Nitrophenoxy)phenyl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
1-[3-(4-nitrophenoxy)phenyl]ethanone (CAS 58636-31-0) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 1-[3-(4-nitrophenoxy)phenyl]ethanone. InChIKey: RATCLDWGKBAGTA-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 1-[3-(4-nitrophenoxy)phenyl]ethanone |
| InChIKey | RATCLDWGKBAGTA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)