Products 586396-26-1
CAS 586396-26-1 appears in our catalog under these names: (3S,5S)-1-((Benzyloxy)carbonyl)-5-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 95%, (3S,5S)-1-benzyloxycarbonyl-5-methoxycarbonyl-pyrrolidine-3-carboxylic acid, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3S,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 586396-26-1) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: (3S,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: LRGHQMSTVSRHIH-RYUDHWBXSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (3S,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | LRGHQMSTVSRHIH-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)