CAS 587838-62-8 is the registry number for (R)–N,N–Dimethyl–(1,1'–binaphthalene)–2,2'–diamine. Offered by: GLPBio. Available pack sizes: 100mg.
1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine (CAS 587838-62-8) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine. InChIKey: WJVCDEJWPSGKLR-UHFFFAOYSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine |
| InChIKey | WJVCDEJWPSGKLR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)N |
Computed by PubChem (NCBI)