CAS 921212-80-8 appears in our catalog under these names: (S)–N,N–Dimethyl–(1,1'–binaphthalene)–2,2'–diamine, (S)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine (CAS 921212-80-8) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine. InChIKey: WJVCDEJWPSGKLR-UHFFFAOYSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine |
| InChIKey | WJVCDEJWPSGKLR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)N |
Computed by PubChem (NCBI)