CAS 58819-97-9 is the registry number for 6-(2-Bromoacetyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2-bromoacetyl)-4H-1,4-benzoxazin-3-one (CAS 58819-97-9) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 6-(2-bromoacetyl)-4H-1,4-benzoxazin-3-one. InChIKey: KCLZQHKWRYPSIV-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 6-(2-bromoacetyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | KCLZQHKWRYPSIV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(=O)CBr |
Computed by PubChem (NCBI)