CAS 5883-81-8 is the registry number for 1-Phenyl-2-(phenylamino)ethanone. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-anilino-1-phenylethanone (CAS 5883-81-8) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 2-anilino-1-phenylethanone. InChIKey: BBFMQHFJAVOYJI-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-anilino-1-phenylethanone |
| InChIKey | BBFMQHFJAVOYJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CNC2=CC=CC=C2 |
Computed by PubChem (NCBI)