CAS 588695-35-6 appears in our catalog under these names: 4-Formylphenyl cyclopropanecarboxylate, 95%, 4-Formylphenyl cyclopropanecarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
(4-formylphenyl) cyclopropanecarboxylate (CAS 588695-35-6) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (4-formylphenyl) cyclopropanecarboxylate. InChIKey: FOPSRGQJZYJXAF-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (4-formylphenyl) cyclopropanecarboxylate |
| InChIKey | FOPSRGQJZYJXAF-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)