CAS 58952-14-0 appears in our catalog under these names: 3,4-Dimethoxythiobenzamide, 95%, 3,4-Dimethoxybenzothioamide, 95%, 3,4-dimethoxythiobenzamide, 3,4-Dimethoxythiobenzamide, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg.
3,4-dimethoxybenzenecarbothioamide (CAS 58952-14-0) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 3,4-dimethoxybenzenecarbothioamide. InChIKey: KAOGWKRVOAXQDX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 3,4-dimethoxybenzenecarbothioamide |
| InChIKey | KAOGWKRVOAXQDX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=S)N)OC |
Computed by PubChem (NCBI)