CAS 5896-30-0 is the registry number for 3,7-Dibenzofurandiamine. Offered by: TRC. Available pack sizes: 100mg.
Dibenzofuran-3,7-diamine (CAS 5896-30-0) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: dibenzofuran-3,7-diamine. InChIKey: QQSBWCNELOEITJ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | dibenzofuran-3,7-diamine |
| InChIKey | QQSBWCNELOEITJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)