Products 590357-04-3

CAS 590357-04-3 is the registry number for 3-Formylphenyl cyclopropanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

(3-formylphenyl) cyclopropanecarboxylate (CAS 590357-04-3) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (3-formylphenyl) cyclopropanecarboxylate. InChIKey: KGUFZNHBUQFUNA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3
Molecular weight190.19 g/mol
IUPAC name(3-formylphenyl) cyclopropanecarboxylate
InChIKeyKGUFZNHBUQFUNA-UHFFFAOYSA-N
SMILESC1CC1C(=O)OC2=CC=CC(=C2)C=O

Computed by PubChem (NCBI)