CAS 590357-04-3 is the registry number for 3-Formylphenyl cyclopropanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(3-formylphenyl) cyclopropanecarboxylate (CAS 590357-04-3) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (3-formylphenyl) cyclopropanecarboxylate. InChIKey: KGUFZNHBUQFUNA-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3-formylphenyl) cyclopropanecarboxylate |
| InChIKey | KGUFZNHBUQFUNA-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)