CAS 590391-05-2 is the registry number for 2-(2-Methoxy-5-methylphenyl)-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 10g.
2-(2-methoxy-5-methylphenyl)-1H-indole-3-carbaldehyde (CAS 590391-05-2) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 2-(2-methoxy-5-methylphenyl)-1H-indole-3-carbaldehyde. InChIKey: XFKGQINCPUDDBC-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-(2-methoxy-5-methylphenyl)-1H-indole-3-carbaldehyde |
| InChIKey | XFKGQINCPUDDBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C2=C(C3=CC=CC=C3N2)C=O |
Computed by PubChem (NCBI)