CAS 59131-19-0 appears in our catalog under these names: 2,6-Dimethoxycinnamic acid, 95%, (2E)-3-(2,6-Dimethoxyphenyl)acrylic acid, 9500%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(E)-3-(2,6-dimethoxyphenyl)prop-2-enoic acid (CAS 59131-19-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (E)-3-(2,6-dimethoxyphenyl)prop-2-enoic acid. InChIKey: WILLCJDOWRLEMC-VOTSOKGWSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (E)-3-(2,6-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | WILLCJDOWRLEMC-VOTSOKGWSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)/C=C/C(=O)O |
Computed by PubChem (NCBI)