CAS 591768-77-3 is the registry number for 2-Methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid (CAS 591768-77-3) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid. InChIKey: JBKTTXIKAZSXMB-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid |
| InChIKey | JBKTTXIKAZSXMB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CC(C2)C(=O)O)C=C1 |
Computed by PubChem (NCBI)